missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Histidin-Hydrochlorid Monohydrat, 98 %, Thermo Scientific Chemicals
40.70 € - 1901.46 €
Chemische Identifikatoren
| CAS | 5934-29-2 |
|---|---|
| Summenformel | C6H12ClN3O3 |
| Molekulargewicht (g/mol) | 209.63 |
| MDL-Nummer | MFCD00151027 |
| InChI-Schlüssel | CMXXUDSWGMGYLZ-XRIGFGBMSA-N |
| Synonym | l-histidine hydrochloride hydrate, l-histidine hydrochloride monohydrate, s-2-amino-3-1h-imidazol-4-yl propanoic acid hydrochloride hydrate, h-his-oh.hcl.h2o, l-histidine monohydrochloride monohydrate, l-histidine, monohydrochloride, monohydrate, l-histidin hydrate hydrochloride, histidine, monohydrochloride, monohydrate, l, h-his-ohhclh2o, l-histidine, hydrochloride, monohydrate |
| PubChem CID | 165377 |
| IUPAC-Name | (2S)-2-Amino-3-(1H-Imidazol-5-yl)propansäurehydrat-Hydrochlorid |
| SMILES | C1=C(NC=N1)CC(C(=O)O)N.O.Cl |
| Produktcode | Marke | Menge | Verpackung | Preis | Menge & Verfügbarkeit | ||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Menge | Verpackung | Preis | Menge & Verfügbarkeit | ||||
|
10761442
|
Thermo Scientific Acros
411730250 |
25 g | Kunststoffflasche |
40.70 €
25 Gramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | ||||
|
10095790
|
Thermo Scientific Acros
411731000 |
100 g | Kunststoffflasche |
115.58 €
100 Gramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | ||||
|
10444045
|
Thermo Scientific Acros
411735000 |
500 g | Kunststoffflasche |
438.18 €
500 Gramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | ||||
|
10277563
|
Thermo Scientific Acros
411730025 |
2.5 kg | Kunststoffflasche |
1901.46 €
2.50 Kilogramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | ||||
Beschreibung
Dieses Markenprodukt von Thermo Scientific Chemicals war ursprünglich Teil des Produktportfolios von Acros Organics. Auf einigen Dokumenten und Etiketteninformationen steht möglicherweise noch die bisherige Marke. Die ursprüngliche Produkt- oder Artikelnummer von Acros Organics oder die SKU-Referenz wurde bei Übernahme der Marke durch Thermo Scientific Chemicals nicht geändert.
Chemische Identifikatoren
| 5934-29-2 | |
| 209.63 | |
| CMXXUDSWGMGYLZ-XRIGFGBMSA-N | |
| 165377 | |
| C1=C(NC=N1)CC(C(=O)O)N.O.Cl |
| C6H12ClN3O3 | |
| MFCD00151027 | |
| l-histidine hydrochloride hydrate, l-histidine hydrochloride monohydrate, s-2-amino-3-1h-imidazol-4-yl propanoic acid hydrochloride hydrate, h-his-oh.hcl.h2o, l-histidine monohydrochloride monohydrate, l-histidine, monohydrochloride, monohydrate, l-histidin hydrate hydrochloride, histidine, monohydrochloride, monohydrate, l, h-his-ohhclh2o, l-histidine, hydrochloride, monohydrate | |
| (2S)-2-Amino-3-(1H-Imidazol-5-yl)propansäurehydrat-Hydrochlorid |
Spezifikation
| L-Histidine hydrochloride monohydrate | |
| 200ppm max. | |
| 3 to 5 (2.5% soln. at 25°C) | |
| 10ppm max. | |
| 10ppm max. | |
| 7% to 10% (3 hrs) (145 to 150°C) | |
| C6H12ClN3O3 | |
| 25, 513 | |
| 300ppm max. | |
| 0.1% max. | |
| CMXXUDSWGMGYLZ-XRIGFGBMSA-N | |
| (2S)-2-Amino-3-(1H-Imidazol-5-yl)propansäurehydrat-Hydrochlorid | |
| 209.63 | |
| 209.64 | |
| Kristallpulver oder Kristalle |
| 98% | |
| 5934-29-2 | |
| Weiß | |
| Echt | |
| 98% | |
| 0.5% max. (TLC) | |
| MFCD00151027 | |
| + 9.90 | |
| 10, 4617 | |
| l-histidine hydrochloride hydrate, l-histidine hydrochloride monohydrate, s-2-amino-3-1h-imidazol-4-yl propanoic acid hydrochloride hydrate, h-his-oh.hcl.h2o, l-histidine monohydrochloride monohydrate, l-histidine, monohydrochloride, monohydrate, l-histidin hydrate hydrochloride, histidine, monohydrochloride, monohydrate, l, h-his-ohhclh2o, l-histidine, hydrochloride, monohydrate | |
| C1=C(NC=N1)CC(C(=O)O)N.O.Cl | |
| + 9.90 (20.00°C c=11,6 N HCl) | |
| 165377 | |
| 98% |
Sicherheit und Handhabung
missing translation for 'rtecsNumber' : Gehäuse MS3119000
Produktidentifikator
- L-Histidine hydrochloride monohydrate
RUO – Research Use Only
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts