missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-(4-Fluorophenoxy)Benzonitril, 98 %, Thermo Scientific™
59.90 € - 172.00 €
Chemische Identifikatoren
| CAS | 215589-24-5 |
|---|---|
| Summenformel | C13H8FNO |
| Molekulargewicht (g/mol) | 213.211 |
| MDL-Nummer | MFCD01815090 |
| InChI-Schlüssel | NXVPHQNXBDDVCT-UHFFFAOYSA-N |
| Synonym | 4-4-fluorophenoxy benzonitrile, 4-4-fluorophenoxy benzenecarbonitrile, acmc-1chxs, 4-cyano-4'-fluorodiphenyl ether, benzonitrile,4-4-fluorophenoxy |
| PubChem CID | 1490284 |
| IUPAC-Name | 4-(4-Fluorphenoxy)benzonitril |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)F |
| Produktcode | Marke | Menge | Preis | Menge & Verfügbarkeit | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Menge | Preis | Menge & Verfügbarkeit | |||||
|
15485257
|
Thermo Scientific Alfa Aesar
H32530.14 |
25 g |
59.90 €
25 Gramm |
Bitte melden Sie sich an, um diesen Artikel zu kaufen. Sie benötigen ein Web-Konto? Registrieren Sie sich noch heute! | |||||
|
15495257
|
Thermo Scientific Alfa Aesar
H32530.22 |
100 g | N/A | ||||||
Description
Dieses Markenprodukt von Thermo Scientific war ursprünglich Teil des Produktportfolios von Alfa Aesar.Einige Dokumente und Etiketteninformationen nennen möglicherweise die bisherige Marke.Die ursprüngliche Produkt- oder Artikelnummer bei Alfa Aesar oder die SKU-Referenz wurde im Rahmen des Übergangs der Marke zu Thermo Scientific nicht geändert.
Chemical Identifiers
| 215589-24-5 | |
| 213.211 | |
| NXVPHQNXBDDVCT-UHFFFAOYSA-N | |
| 1490284 | |
| C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)F |
| C13H8FNO | |
| MFCD01815090 | |
| 4-4-fluorophenoxy benzonitrile, 4-4-fluorophenoxy benzenecarbonitrile, acmc-1chxs, 4-cyano-4'-fluorodiphenyl ether, benzonitrile,4-4-fluorophenoxy | |
| 4-(4-Fluorphenoxy)benzonitril |
Specifications
| 4-(4-Fluorophenoxy)benzonitrile | |
| 67°C to 68°C | |
| MFCD01815090 | |
| NXVPHQNXBDDVCT-UHFFFAOYSA-N | |
| 4-(4-Fluorphenoxy)benzonitril | |
| 1490284 | |
| 98% |
| 215589-24-5 | |
| C13H8FNO | |
| 4-4-fluorophenoxy benzonitrile, 4-4-fluorophenoxy benzenecarbonitrile, acmc-1chxs, 4-cyano-4'-fluorodiphenyl ether, benzonitrile,4-4-fluorophenoxy | |
| C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)F | |
| 213.211 | |
| 213.21 |
Safety and Handling
GHS H-Satz
H302-H315-H319-H335
Gesundheitsschädlich bei Verschlucken.
Verursacht Hautreizungen.
Verursacht schwere Augenreizung.
Kann die Atemwege reizen.
P261-P264b-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P330-P332+P313-P362-P501c
Gehäuse H302-H315-H319-H335
missing translation for 'tsca' : Nein
Recommended Storage : Umgebungstemperaturen