Organische Säuren und Derivate
Gefilterte Suchergebnisse
Ethylendiamintetraessigsäure- 0,1 M (0,2 N), gebrauchsfertige NIST-Standardlösung zur volumetrischen Analyse, erfüllt die analytische Spezifikation gemäß EU-Arzneibuch, BP, Fisher Chemical
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Dimethylformamid, zertifizierte AR für Analysen, Fisher Chemical
CAS: 68-12-2 Summenformel: C3H7NO Molekulargewicht (g/mol): 73.10 MDL-Nummer: MFCD00003284 InChI-Schlüssel: ZMXDDKWLCZADIW-UHFFFAOYSA-N Synonym: dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa PubChem CID: 6228 ChEBI: CHEBI:17741 IUPAC-Name: N,N-Dimethylformamid SMILES: CN(C)C=O
| InChI-Schlüssel | ZMXDDKWLCZADIW-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | N,N-Dimethylformamid |
| PubChem CID | 6228 |
| CAS | 68-12-2 |
| ChEBI | CHEBI:17741 |
| MDL-Nummer | MFCD00003284 |
| Molekulargewicht (g/mol) | 73.10 |
| SMILES | CN(C)C=O |
| Synonym | dimethylformamide,dimethyl formamide,n,n-dimethylmethanamide,n-formyldimethylamine,formamide, n,n-dimethyl,dmf,dimethylformamid,dimetilformamide,dwumetyloformamid,dmfa |
| Summenformel | C3H7NO |
Methansulfonsäure, 99%, reinst, Thermo Scientific Chemicals
CAS: 75-75-2 Summenformel: CH4O3S Molekulargewicht (g/mol): 96.1 MDL-Nummer: MFCD00007518 InChI-Schlüssel: AFVFQIVMOAPDHO-UHFFFAOYSA-N Synonym: methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane PubChem CID: 6395 ChEBI: CHEBI:27376 IUPAC-Name: Methansulfonsäure SMILES: CS(=O)(=O)O
| InChI-Schlüssel | AFVFQIVMOAPDHO-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methansulfonsäure |
| PubChem CID | 6395 |
| CAS | 75-75-2 |
| ChEBI | CHEBI:27376 |
| MDL-Nummer | MFCD00007518 |
| Molekulargewicht (g/mol) | 96.1 |
| SMILES | CS(=O)(=O)O |
| Synonym | methylsulfonic acid,methanesulphonic acid,methanesulfonicacid,kyselina methansulfonova,methansulfonsaeure,ccris 2783,kyselina methansulfonova czech,ch3so3h,methane sulfonic acid,sulfomethane |
| Summenformel | CH4O3S |
Ethylenebis(oxyethylennitrilo)tetraessigsäure, 98 %, Thermo Scientific Chemicals
CAS: 67-42-5 Summenformel: C14H24N2O10 Molekulargewicht (g/mol): 380.34 MDL-Nummer: MFCD00004291 InChI-Schlüssel: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC-Name: 2-[2-[2-[2-[bis(Carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]essigsäure SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | DEFVIWRASFVYLL-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 2-[2-[2-[2-[bis(Carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]essigsäure |
| PubChem CID | 6207 |
| CAS | 67-42-5 |
| ChEBI | CHEBI:30740 |
| MDL-Nummer | MFCD00004291 |
| Molekulargewicht (g/mol) | 380.34 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| Summenformel | C14H24N2O10 |
4-Nitrophenylphosphat, Dinatriumsalz, Hexahydrat, 98+%, Thermo Scientific Chemicals
CAS: 333338-18-4 Summenformel: C6H4NNa2O6P Molekulargewicht (g/mol): 263.05 MDL-Nummer: MFCD00007319 InChI-Schlüssel: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC-Name: Dinatrium;(4-nitrophenyl)phosphat SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
|---|---|
| IUPAC-Name | Dinatrium;(4-nitrophenyl)phosphat |
| PubChem CID | 77949 |
| CAS | 333338-18-4 |
| MDL-Nummer | MFCD00007319 |
| Molekulargewicht (g/mol) | 263.05 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| Summenformel | C6H4NNa2O6P |
1Heptansulfonsäure, Natriumsalz, 98 %, Thermo Scientific Chemicals
CAS: 22767-50-6 InChI-Schlüssel: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC-Name: Natrium;heptan-1-sulfonat SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | REFMEZARFCPESH-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;heptan-1-sulfonat |
| PubChem CID | 23672332 |
| CAS | 22767-50-6 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
N,N-Dimethylacetamid, wasserfrei, 99.8 %, Thermo Scientific Chemicals
CAS: 127-19-5 Summenformel: C4H9NO Molekulargewicht (g/mol): 87.12 MDL-Nummer: MFCD00008686 InChI-Schlüssel: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC-Name: N,N-Dimethylacetamid SMILES: CN(C)C(C)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | N,N-Dimethylacetamid |
| PubChem CID | 31374 |
| CAS | 127-19-5 |
| ChEBI | CHEBI:84254 |
| MDL-Nummer | MFCD00008686 |
| Molekulargewicht (g/mol) | 87.12 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| Summenformel | C4H9NO |
Propylencarbonat, 99.50 %, Thermo Scientific Chemicals
CAS: 108-32-7 Summenformel: C4H6O3 Molekulargewicht (g/mol): 102.09 MDL-Nummer: MFCD00005385,MFCD00798264,MFCD00798265 InChI-Schlüssel: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC-Name: 4-methyl-1,3-dioxolan-2-on SMILES: CC1COC(=O)O1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
|---|---|
| IUPAC-Name | 4-methyl-1,3-dioxolan-2-on |
| PubChem CID | 7924 |
| CAS | 108-32-7 |
| MDL-Nummer | MFCD00005385,MFCD00798264,MFCD00798265 |
| Molekulargewicht (g/mol) | 102.09 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| Summenformel | C4H6O3 |
D-Gluconsäure, Kalziumsalz, 99 %, Thermo Scientific Chemicals
CAS: 299-28-5 Summenformel: C12H22CaO14 Molekulargewicht (g/mol): 430.372 MDL-Nummer: MFCD00064209 InChI-Schlüssel: NEEHYRZPVYRGPP-IYEMJOQQSA-L Synonym: calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal PubChem CID: 9290 IUPAC-Name: Natrium;(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoat SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NEEHYRZPVYRGPP-IYEMJOQQSA-L |
|---|---|
| IUPAC-Name | Natrium;(2R,3S,4R,5R)-2,3,4,5,6-Pentahydroxyhexanoat |
| PubChem CID | 9290 |
| CAS | 299-28-5 |
| MDL-Nummer | MFCD00064209 |
| Molekulargewicht (g/mol) | 430.372 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Synonym | calcium gluconate,calcium d-gluconate,calciofon,calglucon,glucobiogen,ebucin,calcicol,calcipur,calglucol,dragocal |
| Summenformel | C12H22CaO14 |
Thermo Scientific Chemicals L-Ascorbinsäure-Natriumsalz, 99%
CAS: 134-03-2 Summenformel: C6H7NaO6 Molekulargewicht (g/mol): 198.11 MDL-Nummer: MFCD00082340 InChI-Schlüssel: IFVCRSPJFHGFCG-HXPAKLQESA-N Synonym: sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate PubChem CID: 131674100 IUPAC-Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on;hydridonatrium SMILES: [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | IFVCRSPJFHGFCG-HXPAKLQESA-N |
|---|---|
| IUPAC-Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-on;hydridonatrium |
| PubChem CID | 131674100 |
| CAS | 134-03-2 |
| MDL-Nummer | MFCD00082340 |
| Molekulargewicht (g/mol) | 198.11 |
| SMILES | [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| Synonym | sodium ascorbate,l-ascorbic acid sodium salt,sodium l-ascorbate,vitamin c sodium,ascorbicin,sodascorbate,cebitate,aminofenitrooxon,natrii ascorbas,monosodium l-ascorbate |
| Summenformel | C6H7NaO6 |
Harnstoff, hochrein, 99%, Thermo Scientific Chemicals
CAS: 57-13-6 Summenformel: CH4N2O Molekulargewicht (g/mol): 60.056 MDL-Nummer: MFCD00008022 InChI-Schlüssel: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC-Name: Harnstoff SMILES: C(=O)(N)N
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Harnstoff |
| PubChem CID | 1176 |
| CAS | 57-13-6 |
| ChEBI | CHEBI:48376 |
| MDL-Nummer | MFCD00008022 |
| Molekulargewicht (g/mol) | 60.056 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| Summenformel | CH4N2O |
Methylbenzoat, 99 %, Thermo Scientific Chemicals
CAS: 93-58-3 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 InChI-Schlüssel: QPJVMBTYPHYUOC-UHFFFAOYSA-N Synonym: methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le PubChem CID: 7150 ChEBI: CHEBI:72775 IUPAC-Name: Methyl-benzoat SMILES: COC(=O)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl-benzoat |
| PubChem CID | 7150 |
| CAS | 93-58-3 |
| ChEBI | CHEBI:72775 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC(=O)C1=CC=CC=C1 |
| Synonym | methylbenzoate,benzoic acid, methyl ester,clorius,benzoic acid methyl ester,niobe oil,oil of niobe,methyl benzenecarboxylate,essence of niobe,oniobe oil,oxidate le |
| Summenformel | C8H8O2 |
2-Mercaptoethanesulfonsäure-Natriumsalz, 98%, Thermo Scientific Chemicals
CAS: 19767-45-4 Summenformel: C2H5NaO3S2 Molekulargewicht (g/mol): 164.18 InChI-Schlüssel: XOGTZOOQQBDUSI-UHFFFAOYSA-M Synonym: mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid PubChem CID: 23662354 IUPAC-Name: Natrium;-2-sulfanylethansulfonat SMILES: C(CS(=O)(=O)[O-])S.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | XOGTZOOQQBDUSI-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;-2-sulfanylethansulfonat |
| PubChem CID | 23662354 |
| CAS | 19767-45-4 |
| Molekulargewicht (g/mol) | 164.18 |
| SMILES | C(CS(=O)(=O)[O-])S.[Na+] |
| Synonym | mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid |
| Summenformel | C2H5NaO3S2 |
Propionsäure, Natriumsalz, 99.0-100.5 %, Thermo Scientific Chemicals
CAS: 137-40-6 Summenformel: C3H5NaO2 Molekulargewicht (g/mol): 96.06 MDL-Nummer: MFCD00002759 InChI-Schlüssel: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC-Name: Natrium;propanoat SMILES: CCC(=O)[O-].[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;propanoat |
| PubChem CID | 2723816 |
| CAS | 137-40-6 |
| MDL-Nummer | MFCD00002759 |
| Molekulargewicht (g/mol) | 96.06 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| Summenformel | C3H5NaO2 |
N-Isopropylacrylamid, 97%, Thermo Scientific Chemicals
CAS: 2210-25-5 Summenformel: C6H11NO Molekulargewicht (g/mol): 113.16 MDL-Nummer: MFCD00041913 InChI-Schlüssel: QNILTEGFHQSKFF-UHFFFAOYSA-N Synonym: n-isopropylacrylamide,nipam,n-iso-propylacrylamide,2-propenamide, n-1-methylethyl,isopropyl acrylamide,acrylamide, n-isopropyl,n-isopropyl acrylamide,n-1-methylethyl-2-propenamide,isopropylamid kyseliny akrylove,unii-b7gff17l9u PubChem CID: 16637 SMILES: CC(C)NC(=O)C=C
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | QNILTEGFHQSKFF-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 16637 |
| CAS | 2210-25-5 |
| MDL-Nummer | MFCD00041913 |
| Molekulargewicht (g/mol) | 113.16 |
| SMILES | CC(C)NC(=O)C=C |
| Synonym | n-isopropylacrylamide,nipam,n-iso-propylacrylamide,2-propenamide, n-1-methylethyl,isopropyl acrylamide,acrylamide, n-isopropyl,n-isopropyl acrylamide,n-1-methylethyl-2-propenamide,isopropylamid kyseliny akrylove,unii-b7gff17l9u |
| Summenformel | C6H11NO |